C26H25NO4 — CID 123697945
2-[2-(1-hydroxyethyl)-1-benzofuran-5-yl]-N-[(2-methoxyphenyl)-phenylmethyl]acetamide (PubChem CID 123697945) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[2-(1-hydroxyethyl)-1-benzofuran-5-yl]-N-[(2-methoxyphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[2-(1-hydroxyethyl)-1-benzofuran-5-yl]-N-[(2-methoxyphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 123697945 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[2-(1-hydroxyethyl)-1-benzofuran-5-yl]-N-[(2-methoxyphenyl)-phenylmethyl]acetamide |
| SMILES | COc1ccccc1C(NC(=O)Cc1ccc2oc(C(C)O)cc2c1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO4/c1-17(28)24-16-20-14-18(12-13-22(20)31-24)15-25(29)27-26(19-8-4-3-5-9-19)21-10-6-7-11-23(21)30-2/h3-14,16-17,26,28H,15H2,1-2H3,(H,27,29) |
| InChIKey | AXZLRXNLKRXWGK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |