C22H21ClN2O3S — CID 123698364
[3-[3-[4-chloro-N-(1,3-thiazol-2-yl)anilino]-3-oxopropyl]phenyl] butanoate (PubChem CID 123698364) has the molecular formula C22H21ClN2O3S and a molecular weight of 428.94 g/mol. Its IUPAC name is [3-[3-[4-chloro-N-(1,3-thiazol-2-yl)anilino]-3-oxopropyl]phenyl] butanoate.
| Compound Name | [3-[3-[4-chloro-N-(1,3-thiazol-2-yl)anilino]-3-oxopropyl]phenyl] butanoate |
|---|---|
| PubChem CID | 123698364 |
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [3-[3-[4-chloro-N-(1,3-thiazol-2-yl)anilino]-3-oxopropyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1cccc(CCC(=O)N(c2ccc(Cl)cc2)c2nccs2)c1 |
| InChI | InChI=1S/C22H21ClN2O3S/c1-2-4-21(27)28-19-6-3-5-16(15-19)7-12-20(26)25(22-24-13-14-29-22)18-10-8-17(23)9-11-18/h3,5-6,8-11,13-15H,2,4,7,12H2,1H3 |
| InChIKey | RAZYASSVMVZPEQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|