C16H24N5O10P — CID 123699297
[(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2R,4R,5R)-4,5,6-trihydroxy-3-oxohexan-2-yl] hydrogen phosphate (PubChem CID 123699297) has the molecular formula C16H24N5O10P and a molecular weight of 477.37 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2R,4R,5R)-4,5,6-trihydroxy-3-oxohexan-2-yl] hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2R,4R,5R)-4,5,6-trihydroxy-3-oxohexan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 123699297 |
| Molecular Formula | C16H24N5O10P |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2R,4R,5R)-4,5,6-trihydroxy-3-oxohexan-2-yl] hydrogen phosphate |
| SMILES | C[C@@H](OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)CC1O)C(=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H24N5O10P/c1-7(13(25)14(26)9(24)3-22)31-32(27,28)29-4-10-8(23)2-11(30-10)21-6-20-12-15(17)18-5-19-16(12)21/h5-11,14,22-24,26H,2-4H2,1H3,(H,27,28)(H2,17,18,19)/t7-,8?,9-,10-,11-,14-/m1/s1 |
| InChIKey | FIADXOKEPWOGGS-ZUETYRHDSA-N |
| XLogP | -2.14 |
| TPSA | 232.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|