C12H18O2S — CID 123699557
5,7-dimethyl-2-methylsulfonylnona-2,3,4,7-tetraene (PubChem CID 123699557) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 5,7-dimethyl-2-methylsulfonylnona-2,3,4,7-tetraene.
| Compound Name | 5,7-dimethyl-2-methylsulfonylnona-2,3,4,7-tetraene |
|---|---|
| PubChem CID | 123699557 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5,7-dimethyl-2-methylsulfonylnona-2,3,4,7-tetraene |
| SMILES | CC=C(C)CC(C)=C=C=C(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H18O2S/c1-6-10(2)9-11(3)7-8-12(4)15(5,13)14/h6H,9H2,1-5H3/b10-6?,12-11+ |
| InChIKey | BPSDMENERSEKTR-IAFLQIKTSA-N |
| XLogP | 2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|