C18H35NO2S — CID 123700144
tert-butyl 2-[3-(3,3-dimethylbutylsulfanyl)propyl]pyrrolidine-1-carboxylate (PubChem CID 123700144) has the molecular formula C18H35NO2S and a molecular weight of 329.55 g/mol. Its IUPAC name is tert-butyl 2-[3-(3,3-dimethylbutylsulfanyl)propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(3,3-dimethylbutylsulfanyl)propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123700144 |
| Molecular Formula | C18H35NO2S |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | tert-butyl 2-[3-(3,3-dimethylbutylsulfanyl)propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)CCSCCCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO2S/c1-17(2,3)11-14-22-13-8-10-15-9-7-12-19(15)16(20)21-18(4,5)6/h15H,7-14H2,1-6H3 |
| InChIKey | NCVVBCOCBDRACO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|