C15H26F3NO2S — CID 123205887
2-methylbutan-2-yl 2-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 123205887) has the molecular formula C15H26F3NO2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-methylbutan-2-yl 2-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl 2-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123205887 |
| Molecular Formula | C15H26F3NO2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-methylbutan-2-yl 2-[2-(3,3,3-trifluoropropylsulfanyl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCCC1CCSCCC(F)(F)F |
| InChI | InChI=1S/C15H26F3NO2S/c1-4-14(2,3)21-13(20)19-9-5-6-12(19)7-10-22-11-8-15(16,17)18/h12H,4-11H2,1-3H3 |
| InChIKey | KCGXNACTZMIWFC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|