C23H39N3O6S — CID 123701151
5-(3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 123701151) has the molecular formula C23H39N3O6S and a molecular weight of 485.65 g/mol. Its IUPAC name is 5-(3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-(3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 123701151 |
| Molecular Formula | C23H39N3O6S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 5-(3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | C#CCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)N(CC)C21 |
| InChI | InChI=1S/C23H39N3O6S/c1-3-10-29-12-14-31-16-17-32-15-13-30-11-9-24-21(27)8-6-5-7-20-22-19(18-33-20)25-23(28)26(22)4-2/h1,19-20,22H,4-18H2,2H3,(H,24,27)(H,25,28) |
| InChIKey | RUTADYCWQKUEPE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|