C23H41N3O8S — CID 87756914
3-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 87756914) has the molecular formula C23H41N3O8S and a molecular weight of 519.66 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 87756914 |
| Molecular Formula | C23H41N3O8S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 3-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-3-ethyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CCN1C(=O)N[C@H]2CS[C@@H](CCCCC(=O)NCCOCCOCCOCCOCCC(=O)O)[C@H]21 |
| InChI | InChI=1S/C23H41N3O8S/c1-2-26-22-18(25-23(26)30)17-35-19(22)5-3-4-6-20(27)24-8-10-32-12-14-34-16-15-33-13-11-31-9-7-21(28)29/h18-19,22H,2-17H2,1H3,(H,24,27)(H,25,30)(H,28,29)/t18-,19-,22-/m0/s1 |
| InChIKey | GEFSEZHZLGWAJK-IPJJNNNSSA-N |
| XLogP | 1.10 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|