C24H29FN2O4 — CID 123701770
N-[1-[4-[1-[2-fluoro-4-(oxolan-3-yloxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide (PubChem CID 123701770) has the molecular formula C24H29FN2O4 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[1-[4-[1-[2-fluoro-4-(oxolan-3-yloxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide.
| Compound Name | N-[1-[4-[1-[2-fluoro-4-(oxolan-3-yloxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 123701770 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[1-[4-[1-[2-fluoro-4-(oxolan-3-yloxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1ccc(OC2CCN(c3ccc(OC4CCOC4)cc3F)C2)cc1 |
| InChI | InChI=1S/C24H29FN2O4/c1-16(26-17(2)28)18-3-5-19(6-4-18)30-21-9-11-27(14-21)24-8-7-20(13-23(24)25)31-22-10-12-29-15-22/h3-8,13,16,21-22H,9-12,14-15H2,1-2H3,(H,26,28) |
| InChIKey | NHLXDKZWUVOZDX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|