C13H29N — CID 123701896
3,4-diethyl-N,2-dimethylheptan-1-amine (PubChem CID 123701896) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is 3,4-diethyl-N,2-dimethylheptan-1-amine.
| Compound Name | 3,4-diethyl-N,2-dimethylheptan-1-amine |
|---|---|
| PubChem CID | 123701896 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | 3,4-diethyl-N,2-dimethylheptan-1-amine |
| SMILES | CCCC(CC)C(CC)C(C)CNC |
| InChI | InChI=1S/C13H29N/c1-6-9-12(7-2)13(8-3)11(4)10-14-5/h11-14H,6-10H2,1-5H3 |
| InChIKey | DASDOCMCJDNZGO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |