C11H14N2 — CID 123702395
3a,4,4a,5,8a,8b-hexahydro-3H-cyclopenta[b]indol-8-imine (PubChem CID 123702395) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3a,4,4a,5,8a,8b-hexahydro-3H-cyclopenta[b]indol-8-imine.
| Compound Name | 3a,4,4a,5,8a,8b-hexahydro-3H-cyclopenta[b]indol-8-imine |
|---|---|
| PubChem CID | 123702395 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3a,4,4a,5,8a,8b-hexahydro-3H-cyclopenta[b]indol-8-imine |
| SMILES | [H]/N=C1\C=CCC2NC3CC=CC3C12 |
| InChI | InChI=1S/C11H14N2/c12-8-4-2-6-10-11(8)7-3-1-5-9(7)13-10/h1-4,7,9-13H,5-6H2/b12-8+ |
| InChIKey | RGSHLOYREXHCFC-XYOKQWHBSA-N |
| XLogP | 1.50 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|