C10H9F2N3S — CID 123703130
6,7-difluoro-3-(methylaminomethyl)-1H-1,8-naphthyridine-2-thione (PubChem CID 123703130) has the molecular formula C10H9F2N3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 6,7-difluoro-3-(methylaminomethyl)-1H-1,8-naphthyridine-2-thione.
| Compound Name | 6,7-difluoro-3-(methylaminomethyl)-1H-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 123703130 |
| Molecular Formula | C10H9F2N3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 6,7-difluoro-3-(methylaminomethyl)-1H-1,8-naphthyridine-2-thione |
| SMILES | CNCc1cc2cc(F)c(F)nc2[nH]c1=S |
| InChI | InChI=1S/C10H9F2N3S/c1-13-4-6-2-5-3-7(11)8(12)14-9(5)15-10(6)16/h2-3,13H,4H2,1H3,(H,14,15,16) |
| InChIKey | SCCGWQSBYVCJJN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|