C23H26N2O — CID 123704216
1-[(3R,4R)-1-benzyl-3-methylpiperidin-4-yl]-3-ethylideneindol-2-one (PubChem CID 123704216) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(3R,4R)-1-benzyl-3-methylpiperidin-4-yl]-3-ethylideneindol-2-one.
| Compound Name | 1-[(3R,4R)-1-benzyl-3-methylpiperidin-4-yl]-3-ethylideneindol-2-one |
|---|---|
| PubChem CID | 123704216 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[(3R,4R)-1-benzyl-3-methylpiperidin-4-yl]-3-ethylideneindol-2-one |
| SMILES | CC=C1C(=O)N([C@@H]2CCN(Cc3ccccc3)C[C@H]2C)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O/c1-3-19-20-11-7-8-12-22(20)25(23(19)26)21-13-14-24(15-17(21)2)16-18-9-5-4-6-10-18/h3-12,17,21H,13-16H2,1-2H3/t17-,21-/m1/s1 |
| InChIKey | QSJLTBXOIUYUKX-DYESRHJHSA-N |
| XLogP | 4.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|