C48H56F2N4O3 — CID 123707969
3-(3,4-difluorobenzoyl)-N-[(3R)-1-docosa-4,7,10,13,16,19-hexaenoylpyrrolidin-3-yl]-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxamide (PubChem CID 123707969) has the molecular formula C48H56F2N4O3 and a molecular weight of 775.00 g/mol. Its IUPAC name is 3-(3,4-difluorobenzoyl)-N-[(3R)-1-docosa-4,7,10,13,16,19-hexaenoylpyrrolidin-3-yl]-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxamide.
| Compound Name | 3-(3,4-difluorobenzoyl)-N-[(3R)-1-docosa-4,7,10,13,16,19-hexaenoylpyrrolidin-3-yl]-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 123707969 |
| Molecular Formula | C48H56F2N4O3 |
| Molecular Weight | 775.00 g/mol |
| Exact Mass | 774.43 |
| IUPAC Name | 3-(3,4-difluorobenzoyl)-N-[(3R)-1-docosa-4,7,10,13,16,19-hexaenoylpyrrolidin-3-yl]-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)N1CC[C@@H](NC(=O)C2=CN(C(=O)c3ccc(F)c(F)c3)CC(C)(C)c3c2[nH]c2ccccc32)C1 |
| InChI | InChI=1S/C48H56F2N4O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-43(55)53-31-30-37(33-53)51-46(56)39-34-54(47(57)36-28-29-40(49)41(50)32-36)35-48(2,3)44-38-25-23-24-26-42(38)52-45(39)44/h5-6,8-9,11-12,14-15,17-18,20-21,23-26,28-29,32,34,37,52H,4,7,10,13,16,19,22,27,30-31,33,35H2,1-3H3,(H,51,56)/t37-/m1/s1 |
| InChIKey | AEMQIZIJIIRXLG-DIPNUNPCSA-N |
| XLogP | 10.42 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.00 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|