About 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine
4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine (PubChem CID 123710469) has the molecular formula C11H20N3+
and a molecular weight of 194.30 g/mol. Its IUPAC name is 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine.
Molecular Properties
| Compound Name | 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine |
| PubChem CID | 123710469 |
| Molecular Formula | C11H20N3+ |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine |
| SMILES | CCC1=C(N)C(N)=C(CC)[N+](C)=CC1 |
| InChI | InChI=1S/C11H20N3/c1-4-8-6-7-14(3)9(5-2)11(13)10(8)12/h7H,4-6,12-13H2,1-3H3/q+1 |
| InChIKey | FHJDUDBPEWTDEC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine?
The IUPAC name of 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine (CID 123710469) is 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine.
What is the SMILES notation for 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine?
The canonical SMILES for 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine is CCC1=C(N)C(N)=C(CC)[N+](C)=CC1.
What is the InChIKey of 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine?
The InChIKey is FHJDUDBPEWTDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N3/c1-4-8-6-7-14(3)9(5-2)11(13)10(8)12/h7H,4-6,12-13H2,1-3H3/q+1.
What are the key properties of 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine?
4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine has a molecular weight of 194.30 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diethyl-1-methyl-3H-azepin-1-ium-5,6-diamine is sourced from PubChem (CID 123710469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).