C14H25N3 — CID 171106730
(2E,4Z)-3-(butylideneamino)-2-(ethylideneamino)-5-methylhepta-2,4-dien-4-amine (PubChem CID 171106730) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is (2E,4Z)-3-(butylideneamino)-2-(ethylideneamino)-5-methylhepta-2,4-dien-4-amine.
| Compound Name | (2E,4Z)-3-(butylideneamino)-2-(ethylideneamino)-5-methylhepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 171106730 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (2E,4Z)-3-(butylideneamino)-2-(ethylideneamino)-5-methylhepta-2,4-dien-4-amine |
| SMILES | C/C=N/C(C)=C(/N=C/CCC)C(\N)=C(/C)CC |
| InChI | InChI=1S/C14H25N3/c1-6-9-10-17-14(12(5)16-8-3)13(15)11(4)7-2/h8,10H,6-7,9,15H2,1-5H3/b13-11-,14-12+,16-8+,17-10+ |
| InChIKey | IYLIKOPNYABXKW-CBAOZJGLSA-N |
| XLogP | 3.82 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|