C10H17N — CID 91516831
N-(2,4-dimethylpenta-1,3-dien-3-yl)propan-1-imine (PubChem CID 91516831) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-(2,4-dimethylpenta-1,3-dien-3-yl)propan-1-imine.
| Compound Name | N-(2,4-dimethylpenta-1,3-dien-3-yl)propan-1-imine |
|---|---|
| PubChem CID | 91516831 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-(2,4-dimethylpenta-1,3-dien-3-yl)propan-1-imine |
| SMILES | C=C(C)C(/N=C/CC)=C(C)C |
| InChI | InChI=1S/C10H17N/c1-6-7-11-10(8(2)3)9(4)5/h7H,2,6H2,1,3-5H3/b11-7+ |
| InChIKey | JCTQBUKZYZUERG-YRNVUSSQSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|