C9H14FN — CID 163860907
N-[(2E,4Z)-3-fluoro-4-methylhexa-2,4-dien-2-yl]ethanimine (PubChem CID 163860907) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is N-[(2E,4Z)-3-fluoro-4-methylhexa-2,4-dien-2-yl]ethanimine.
| Compound Name | N-[(2E,4Z)-3-fluoro-4-methylhexa-2,4-dien-2-yl]ethanimine |
|---|---|
| PubChem CID | 163860907 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(2E,4Z)-3-fluoro-4-methylhexa-2,4-dien-2-yl]ethanimine |
| SMILES | C/C=C(C)\C(F)=C(C)/N=C/C |
| InChI | InChI=1S/C9H14FN/c1-5-7(3)9(10)8(4)11-6-2/h5-6H,1-4H3/b7-5-,9-8+,11-6+ |
| InChIKey | PCKNXZNLSUADHH-RHSAOINYSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|