C14H24N2 — CID 54326637
N-methylethanimine;1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-ylidene)ethanamine (PubChem CID 54326637) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-methylethanimine;1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-ylidene)ethanamine.
| Compound Name | N-methylethanimine;1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-ylidene)ethanamine |
|---|---|
| PubChem CID | 54326637 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-methylethanimine;1-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-ylidene)ethanamine |
| SMILES | C/C=N/C.CC(N)=C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C11H17N.C3H7N/c1-6-7(2)9(4)11(8(6)3)10(5)12;1-3-4-2/h12H2,1-5H3;3H,1-2H3/b;4-3+ |
| InChIKey | SVKMPPIGEWRYCE-SCBDLNNBSA-N |
| XLogP | 3.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|