C17H10F4N2O — CID 123711068
3-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]prop-2-enenitrile (PubChem CID 123711068) has the molecular formula C17H10F4N2O and a molecular weight of 334.27 g/mol. Its IUPAC name is 3-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]prop-2-enenitrile.
| Compound Name | 3-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 123711068 |
| Molecular Formula | C17H10F4N2O |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-[6-[[2-(2,4-difluorophenyl)oxiran-2-yl]-difluoromethyl]-3-pyridinyl]prop-2-enenitrile |
| SMILES | N#CC=Cc1ccc(C(F)(F)C2(c3ccc(F)cc3F)CO2)nc1 |
| InChI | InChI=1S/C17H10F4N2O/c18-12-4-5-13(14(19)8-12)16(10-24-16)17(20,21)15-6-3-11(9-23-15)2-1-7-22/h1-6,8-9H,10H2 |
| InChIKey | ROGZTVQCBXOYKO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|