C11H17N — CID 123712763
5-methyl-6-[(1Z)-3-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydropyridine (PubChem CID 123712763) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 5-methyl-6-[(1Z)-3-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydropyridine.
| Compound Name | 5-methyl-6-[(1Z)-3-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 123712763 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 5-methyl-6-[(1Z)-3-methylbuta-1,3-dienyl]-2,3,4,5-tetrahydropyridine |
| SMILES | C=C(C)/C=C\C1=NCCCC1C |
| InChI | InChI=1S/C11H17N/c1-9(2)6-7-11-10(3)5-4-8-12-11/h6-7,10H,1,4-5,8H2,2-3H3/b7-6- |
| InChIKey | GFOQKXCWHDYEHZ-SREVYHEPSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|