C28H34FNO3S — CID 123713205
8-(2-fluoroacetyl)-11-hydroxy-9,13-dimethyl-6-(thiophen-2-ylmethyl)-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 123713205) has the molecular formula C28H34FNO3S and a molecular weight of 483.65 g/mol. Its IUPAC name is 8-(2-fluoroacetyl)-11-hydroxy-9,13-dimethyl-6-(thiophen-2-ylmethyl)-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | 8-(2-fluoroacetyl)-11-hydroxy-9,13-dimethyl-6-(thiophen-2-ylmethyl)-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 123713205 |
| Molecular Formula | C28H34FNO3S |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 8-(2-fluoroacetyl)-11-hydroxy-9,13-dimethyl-6-(thiophen-2-ylmethyl)-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CC1CN(Cc3cccs3)CC12C(=O)CF |
| InChI | InChI=1S/C28H34FNO3S/c1-26-8-7-19(31)10-17(26)5-6-21-22-11-18-14-30(15-20-4-3-9-34-20)16-28(18,24(33)13-29)27(22,2)12-23(32)25(21)26/h3-4,7-10,18,21-23,25,32H,5-6,11-16H2,1-2H3 |
| InChIKey | JOCFTEGXWFZBHC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |