C35H44N2O5 — CID 167165033
(4R)-6-[4-(4-amino-2-methylidenebutyl)benzoyl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 167165033) has the molecular formula C35H44N2O5 and a molecular weight of 572.75 g/mol. Its IUPAC name is (4R)-6-[4-(4-amino-2-methylidenebutyl)benzoyl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R)-6-[4-(4-amino-2-methylidenebutyl)benzoyl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 167165033 |
| Molecular Formula | C35H44N2O5 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | (4R)-6-[4-(4-amino-2-methylidenebutyl)benzoyl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | C=C(CCN)Cc1ccc(C(=O)N2C[C@@H]3CC4C5CCC6=CC(=O)C=CC6(C)C5C(O)CC4(C)C3(C(=O)CO)C2)cc1 |
| InChI | InChI=1S/C35H44N2O5/c1-21(11-13-36)14-22-4-6-23(7-5-22)32(42)37-18-25-16-28-27-9-8-24-15-26(39)10-12-33(24,2)31(27)29(40)17-34(28,3)35(25,20-37)30(41)19-38/h4-7,10,12,15,25,27-29,31,38,40H,1,8-9,11,13-14,16-20,36H2,2-3H3/t25-,27?,28?,29?,31?,33?,34?,35?/m0/s1 |
| InChIKey | DHJCBPXRROZNCO-ZPUIYIBASA-N |
| XLogP | 3.64 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|