C17H13F3NO2+ — CID 123713632
4-methylidene-7-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazepin-4-ium-5-one (PubChem CID 123713632) has the molecular formula C17H13F3NO2+ and a molecular weight of 320.29 g/mol. Its IUPAC name is 4-methylidene-7-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazepin-4-ium-5-one.
| Compound Name | 4-methylidene-7-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazepin-4-ium-5-one |
|---|---|
| PubChem CID | 123713632 |
| Molecular Formula | C17H13F3NO2+ |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-methylidene-7-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzoxazepin-4-ium-5-one |
| SMILES | C=[N+]1CCOc2ccc(-c3ccc(C(F)(F)F)cc3)cc2C1=O |
| InChI | InChI=1S/C17H13F3NO2/c1-21-8-9-23-15-7-4-12(10-14(15)16(21)22)11-2-5-13(6-3-11)17(18,19)20/h2-7,10H,1,8-9H2/q+1 |
| InChIKey | HFORJUTVIAKUGY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|