C16H13F2N2O+ — CID 123715802
3-(3,5-difluorophenoxy)-4-(3-methylazet-1-ium-1-yl)aniline (PubChem CID 123715802) has the molecular formula C16H13F2N2O+ and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-(3,5-difluorophenoxy)-4-(3-methylazet-1-ium-1-yl)aniline.
| Compound Name | 3-(3,5-difluorophenoxy)-4-(3-methylazet-1-ium-1-yl)aniline |
|---|---|
| PubChem CID | 123715802 |
| Molecular Formula | C16H13F2N2O+ |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-(3,5-difluorophenoxy)-4-(3-methylazet-1-ium-1-yl)aniline |
| SMILES | CC1=C[N+](c2ccc(N)cc2Oc2cc(F)cc(F)c2)=C1 |
| InChI | InChI=1S/C16H13F2N2O/c1-10-8-20(9-10)15-3-2-13(19)7-16(15)21-14-5-11(17)4-12(18)6-14/h2-9H,19H2,1H3/q+1 |
| InChIKey | WWPQIDCNMSJFQE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|