C22H35BrO3 — CID 123716475
2-bromo-1-[3-hydroxy-10-(methoxymethyl)-3-methyl-2,4,5,6,7,8,9,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 123716475) has the molecular formula C22H35BrO3 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-bromo-1-[3-hydroxy-10-(methoxymethyl)-3-methyl-2,4,5,6,7,8,9,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-bromo-1-[3-hydroxy-10-(methoxymethyl)-3-methyl-2,4,5,6,7,8,9,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 123716475 |
| Molecular Formula | C22H35BrO3 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-bromo-1-[3-hydroxy-10-(methoxymethyl)-3-methyl-2,4,5,6,7,8,9,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | COCC12CCC(C)(O)CC1CCC1C3CCC(C(=O)CBr)C3CCC12 |
| InChI | InChI=1S/C22H35BrO3/c1-21(25)9-10-22(13-26-2)14(11-21)3-4-17-15-5-6-18(20(24)12-23)16(15)7-8-19(17)22/h14-19,25H,3-13H2,1-2H3 |
| InChIKey | WTNKSKOICMWUSL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|