C26H34FN5O2 — CID 123718190
N-ethenyl-1-[4-[6-[[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methyl]pyrimidin-4-yl]piperazin-1-yl]-3-methoxybutan-1-imine (PubChem CID 123718190) has the molecular formula C26H34FN5O2 and a molecular weight of 467.59 g/mol. Its IUPAC name is N-ethenyl-1-[4-[6-[[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methyl]pyrimidin-4-yl]piperazin-1-yl]-3-methoxybutan-1-imine.
| Compound Name | N-ethenyl-1-[4-[6-[[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methyl]pyrimidin-4-yl]piperazin-1-yl]-3-methoxybutan-1-imine |
|---|---|
| PubChem CID | 123718190 |
| Molecular Formula | C26H34FN5O2 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | N-ethenyl-1-[4-[6-[[4-fluoro-3-(1-methylcyclopropyl)oxyphenyl]methyl]pyrimidin-4-yl]piperazin-1-yl]-3-methoxybutan-1-imine |
| SMILES | C=C/N=C(\CC(C)OC)N1CCN(c2cc(Cc3ccc(F)c(OC4(C)CC4)c3)ncn2)CC1 |
| InChI | InChI=1S/C26H34FN5O2/c1-5-28-24(14-19(2)33-4)31-10-12-32(13-11-31)25-17-21(29-18-30-25)15-20-6-7-22(27)23(16-20)34-26(3)8-9-26/h5-7,16-19H,1,8-15H2,2-4H3/b28-24+ |
| InChIKey | FWIGAYGDELEOQC-ZZIIXHQDSA-N |
| XLogP | 4.23 |
| TPSA | 63.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|