C23H30ClNO2 — CID 123718937
2-[4-[1-(4-chlorophenyl)-2,2,3-trimethylbut-3-enyl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 123718937) has the molecular formula C23H30ClNO2 and a molecular weight of 387.95 g/mol. Its IUPAC name is 2-[4-[1-(4-chlorophenyl)-2,2,3-trimethylbut-3-enyl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[1-(4-chlorophenyl)-2,2,3-trimethylbut-3-enyl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 123718937 |
| Molecular Formula | C23H30ClNO2 |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[4-[1-(4-chlorophenyl)-2,2,3-trimethylbut-3-enyl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | C=C(C)C(C)(C)C(c1ccc(Cl)cc1)c1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C23H30ClNO2/c1-17(2)23(3,4)22(18-5-9-20(24)10-6-18)19-7-11-21(12-8-19)25(13-15-26)14-16-27/h5-12,22,26-27H,1,13-16H2,2-4H3 |
| InChIKey | KXRPLUIGCGAWMR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|