C6H10NS+ — CID 123718998
4,4-dimethyl-1,4-thiazin-4-ium (PubChem CID 123718998) has the molecular formula C6H10NS+ and a molecular weight of 128.22 g/mol. Its IUPAC name is 4,4-dimethyl-1,4-thiazin-4-ium.
| Compound Name | 4,4-dimethyl-1,4-thiazin-4-ium |
|---|---|
| PubChem CID | 123718998 |
| Molecular Formula | C6H10NS+ |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 4,4-dimethyl-1,4-thiazin-4-ium |
| SMILES | C[N+]1(C)C=CSC=C1 |
| InChI | InChI=1S/C6H10NS/c1-7(2)3-5-8-6-4-7/h3-6H,1-2H3/q+1 |
| InChIKey | VHIBPHWXKCBCGL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|