C31H37NO6 — CID 123719147
4-[2-(2-methoxyethoxy)ethoxy]-2,3-dihydro-1H-isoindole;2-methyl-4-phenylmethoxy-5-prop-1-en-2-ylbenzoic acid (PubChem CID 123719147) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)ethoxy]-2,3-dihydro-1H-isoindole;2-methyl-4-phenylmethoxy-5-prop-1-en-2-ylbenzoic acid.
| Compound Name | 4-[2-(2-methoxyethoxy)ethoxy]-2,3-dihydro-1H-isoindole;2-methyl-4-phenylmethoxy-5-prop-1-en-2-ylbenzoic acid |
|---|---|
| PubChem CID | 123719147 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)ethoxy]-2,3-dihydro-1H-isoindole;2-methyl-4-phenylmethoxy-5-prop-1-en-2-ylbenzoic acid |
| SMILES | C=C(C)c1cc(C(=O)O)c(C)cc1OCc1ccccc1.COCCOCCOc1cccc2c1CNC2 |
| InChI | InChI=1S/C18H18O3.C13H19NO3/c1-12(2)15-10-16(18(19)20)13(3)9-17(15)21-11-14-7-5-4-6-8-14;1-15-5-6-16-7-8-17-13-4-2-3-11-9-14-10-12(11)13/h4-10H,1,11H2,2-3H3,(H,19,20);2-4,14H,5-10H2,1H3 |
| InChIKey | NQDJFUSBIUNLOI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|