C12H26O3 — CID 123719699
3-tert-butyl-1-ethoxyhexane-2,4-diol (PubChem CID 123719699) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-tert-butyl-1-ethoxyhexane-2,4-diol.
| Compound Name | 3-tert-butyl-1-ethoxyhexane-2,4-diol |
|---|---|
| PubChem CID | 123719699 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 3-tert-butyl-1-ethoxyhexane-2,4-diol |
| SMILES | CCOCC(O)C(C(O)CC)C(C)(C)C |
| InChI | InChI=1S/C12H26O3/c1-6-9(13)11(12(3,4)5)10(14)8-15-7-2/h9-11,13-14H,6-8H2,1-5H3 |
| InChIKey | MBHWNORDYVPZCH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |