C14H9Cl2FN2O — CID 123720309
2-(2-amino-3-fluorophenyl)-1-(2,6-dichlorophenyl)-2-iminoethanone (PubChem CID 123720309) has the molecular formula C14H9Cl2FN2O and a molecular weight of 311.14 g/mol. Its IUPAC name is 2-(2-amino-3-fluorophenyl)-1-(2,6-dichlorophenyl)-2-iminoethanone.
| Compound Name | 2-(2-amino-3-fluorophenyl)-1-(2,6-dichlorophenyl)-2-iminoethanone |
|---|---|
| PubChem CID | 123720309 |
| Molecular Formula | C14H9Cl2FN2O |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-(2-amino-3-fluorophenyl)-1-(2,6-dichlorophenyl)-2-iminoethanone |
| SMILES | [H]/N=C(/C(=O)c1c(Cl)cccc1Cl)c1cccc(F)c1N |
| InChI | InChI=1S/C14H9Cl2FN2O/c15-8-4-2-5-9(16)11(8)14(20)13(19)7-3-1-6-10(17)12(7)18/h1-6,19H,18H2/b19-13+ |
| InChIKey | APNITUXQPXSQIO-CPNJWEJPSA-N |
| XLogP | 3.97 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|