C14H7BrClFN2O — CID 123721507
3-bromo-8-chloro-2-(4-fluorophenyl)-2,7-naphthyridin-1-one (PubChem CID 123721507) has the molecular formula C14H7BrClFN2O and a molecular weight of 353.58 g/mol. Its IUPAC name is 3-bromo-8-chloro-2-(4-fluorophenyl)-2,7-naphthyridin-1-one.
| Compound Name | 3-bromo-8-chloro-2-(4-fluorophenyl)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 123721507 |
| Molecular Formula | C14H7BrClFN2O |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 3-bromo-8-chloro-2-(4-fluorophenyl)-2,7-naphthyridin-1-one |
| SMILES | O=c1c2c(Cl)nccc2cc(Br)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H7BrClFN2O/c15-11-7-8-5-6-18-13(16)12(8)14(20)19(11)10-3-1-9(17)2-4-10/h1-7H |
| InChIKey | PJPOBVHCASTIQT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|