C24H28F3N5O2 — CID 123721690
2-methoxy-3-prop-1-enyl-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-2-(trifluoromethyl)hexa-3,5-dien-1-one (PubChem CID 123721690) has the molecular formula C24H28F3N5O2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 2-methoxy-3-prop-1-enyl-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-2-(trifluoromethyl)hexa-3,5-dien-1-one.
| Compound Name | 2-methoxy-3-prop-1-enyl-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-2-(trifluoromethyl)hexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 123721690 |
| Molecular Formula | C24H28F3N5O2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-methoxy-3-prop-1-enyl-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-2-(trifluoromethyl)hexa-3,5-dien-1-one |
| SMILES | C=CC=C(C=CC)C(OC)(C(=O)N1CCCC2C1CCN2c1ncnc2[nH]ccc12)C(F)(F)F |
| InChI | InChI=1S/C24H28F3N5O2/c1-4-7-16(8-5-2)23(34-3,24(25,26)27)22(33)32-13-6-9-18-19(32)11-14-31(18)21-17-10-12-28-20(17)29-15-30-21/h4-5,7-8,10,12,15,18-19H,1,6,9,11,13-14H2,2-3H3,(H,28,29,30) |
| InChIKey | UBOGVXCIZIADLS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|