C11H14N4 — CID 67251949
4-(2-methylpyrrolidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 67251949) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-(2-methylpyrrolidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-(2-methylpyrrolidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 67251949 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 4-(2-methylpyrrolidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CC1CCCN1c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C11H14N4/c1-8-3-2-6-15(8)11-9-4-5-12-10(9)13-7-14-11/h4-5,7-8H,2-3,6H2,1H3,(H,12,13,14) |
| InChIKey | PFKOCKCPPMZYIV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |