C39H32ClF5N2O3S — CID 123721937
benzyl 4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]-[(4-propan-2-ylphenyl)methyl]amino]benzoate (PubChem CID 123721937) has the molecular formula C39H32ClF5N2O3S and a molecular weight of 739.21 g/mol. Its IUPAC name is benzyl 4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]-[(4-propan-2-ylphenyl)methyl]amino]benzoate.
| Compound Name | benzyl 4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]-[(4-propan-2-ylphenyl)methyl]amino]benzoate |
|---|---|
| PubChem CID | 123721937 |
| Molecular Formula | C39H32ClF5N2O3S |
| Molecular Weight | 739.21 g/mol |
| Exact Mass | 738.17 |
| IUPAC Name | benzyl 4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfanylamino]acetyl]-[(4-propan-2-ylphenyl)methyl]amino]benzoate |
| SMILES | CC(C)c1ccc(CN(C(=O)CN(Cc2ccc(Cl)cc2)Sc2c(F)c(F)c(F)c(F)c2F)c2ccc(C(=O)OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H32ClF5N2O3S/c1-24(2)28-12-8-26(9-13-28)21-47(31-18-14-29(15-19-31)39(49)50-23-27-6-4-3-5-7-27)32(48)22-46(20-25-10-16-30(40)17-11-25)51-38-36(44)34(42)33(41)35(43)37(38)45/h3-19,24H,20-23H2,1-2H3 |
| InChIKey | PHMKKSSWEVQWSJ-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.21 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|