C23H46 — CID 123722303
2,3,6,8,11-pentamethyltetradecylcyclobutane (PubChem CID 123722303) has the molecular formula C23H46 and a molecular weight of 322.62 g/mol. Its IUPAC name is 2,3,6,8,11-pentamethyltetradecylcyclobutane.
| Compound Name | 2,3,6,8,11-pentamethyltetradecylcyclobutane |
|---|---|
| PubChem CID | 123722303 |
| Molecular Formula | C23H46 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 322.36 |
| IUPAC Name | 2,3,6,8,11-pentamethyltetradecylcyclobutane |
| SMILES | CCCC(C)CCC(C)CC(C)CCC(C)C(C)CC1CCC1 |
| InChI | InChI=1S/C23H46/c1-7-9-18(2)12-13-19(3)16-20(4)14-15-21(5)22(6)17-23-10-8-11-23/h18-23H,7-17H2,1-6H3 |
| InChIKey | XEZDRLGUPUHSLV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |