C40H51N3O2 — CID 123722884
1,5-diimino-1-[3-[(8Z)-11-imino-10-methoxy-12-methyl-7-methylidene-9-(2-methylidenebut-3-enyl)trideca-8,12-dien-3-yl]phenyl]-7-phenylheptan-4-one (PubChem CID 123722884) has the molecular formula C40H51N3O2 and a molecular weight of 605.87 g/mol. Its IUPAC name is 1,5-diimino-1-[3-[(8Z)-11-imino-10-methoxy-12-methyl-7-methylidene-9-(2-methylidenebut-3-enyl)trideca-8,12-dien-3-yl]phenyl]-7-phenylheptan-4-one.
| Compound Name | 1,5-diimino-1-[3-[(8Z)-11-imino-10-methoxy-12-methyl-7-methylidene-9-(2-methylidenebut-3-enyl)trideca-8,12-dien-3-yl]phenyl]-7-phenylheptan-4-one |
|---|---|
| PubChem CID | 123722884 |
| Molecular Formula | C40H51N3O2 |
| Molecular Weight | 605.87 g/mol |
| Exact Mass | 605.40 |
| IUPAC Name | 1,5-diimino-1-[3-[(8Z)-11-imino-10-methoxy-12-methyl-7-methylidene-9-(2-methylidenebut-3-enyl)trideca-8,12-dien-3-yl]phenyl]-7-phenylheptan-4-one |
| SMILES | [H]/N=C(\CCc1ccccc1)C(=O)CC/C(=N\[H])c1cccc(C(CC)CCCC(=C)/C=C(/CC(=C)C=C)C(OC)/C(=N/[H])C(=C)C)c1 |
| InChI | InChI=1S/C40H51N3O2/c1-8-29(5)25-35(40(45-7)39(43)28(3)4)26-30(6)15-13-18-32(9-2)33-19-14-20-34(27-33)36(41)23-24-38(44)37(42)22-21-31-16-11-10-12-17-31/h8,10-12,14,16-17,19-20,26-27,32,40-43H,1,3,5-6,9,13,15,18,21-25H2,2,4,7H3/b35-26-,41-36+,42-37+,43-39+ |
| InChIKey | XXOPWQKWQCYKNC-ZDYLFFIZSA-N |
| XLogP | 9.95 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.87 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|