C39H55NO2 — CID 142243240
5-[2-(cyclohexanecarboximidoyl)phenyl]-2-methyl-6-[5-[3-[(3Z)-4-methylhexa-3,5-dienyl]phenyl]hexoxy]hexan-3-one (PubChem CID 142243240) has the molecular formula C39H55NO2 and a molecular weight of 569.87 g/mol. Its IUPAC name is 5-[2-(cyclohexanecarboximidoyl)phenyl]-2-methyl-6-[5-[3-[(3Z)-4-methylhexa-3,5-dienyl]phenyl]hexoxy]hexan-3-one.
| Compound Name | 5-[2-(cyclohexanecarboximidoyl)phenyl]-2-methyl-6-[5-[3-[(3Z)-4-methylhexa-3,5-dienyl]phenyl]hexoxy]hexan-3-one |
|---|---|
| PubChem CID | 142243240 |
| Molecular Formula | C39H55NO2 |
| Molecular Weight | 569.87 g/mol |
| Exact Mass | 569.42 |
| IUPAC Name | 5-[2-(cyclohexanecarboximidoyl)phenyl]-2-methyl-6-[5-[3-[(3Z)-4-methylhexa-3,5-dienyl]phenyl]hexoxy]hexan-3-one |
| SMILES | [H]/N=C(/c1ccccc1C(COCCCCC(C)c1cccc(CC/C=C(/C)C=C)c1)CC(=O)C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C39H55NO2/c1-6-30(4)16-14-18-32-19-15-22-34(26-32)31(5)17-12-13-25-42-28-35(27-38(41)29(2)3)36-23-10-11-24-37(36)39(40)33-20-8-7-9-21-33/h6,10-11,15-16,19,22-24,26,29,31,33,35,40H,1,7-9,12-14,17-18,20-21,25,27-28H2,2-5H3/b30-16-,40-39+ |
| InChIKey | KJSQIQHANHVUIH-LWZUIANSSA-N |
| XLogP | 10.39 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.87 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|