C26H30FNO2 — CID 142190195
(E)-1-(3,4-dimethylphenyl)-5-[4-fluoro-3-(oxan-4-ylmethyl)phenyl]-4-iminohex-1-en-3-one (PubChem CID 142190195) has the molecular formula C26H30FNO2 and a molecular weight of 407.53 g/mol. Its IUPAC name is (E)-1-(3,4-dimethylphenyl)-5-[4-fluoro-3-(oxan-4-ylmethyl)phenyl]-4-iminohex-1-en-3-one.
| Compound Name | (E)-1-(3,4-dimethylphenyl)-5-[4-fluoro-3-(oxan-4-ylmethyl)phenyl]-4-iminohex-1-en-3-one |
|---|---|
| PubChem CID | 142190195 |
| Molecular Formula | C26H30FNO2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (E)-1-(3,4-dimethylphenyl)-5-[4-fluoro-3-(oxan-4-ylmethyl)phenyl]-4-iminohex-1-en-3-one |
| SMILES | [H]/N=C(\C(=O)/C=C/c1ccc(C)c(C)c1)C(C)c1ccc(F)c(CC2CCOCC2)c1 |
| InChI | InChI=1S/C26H30FNO2/c1-17-4-5-20(14-18(17)2)6-9-25(29)26(28)19(3)22-7-8-24(27)23(16-22)15-21-10-12-30-13-11-21/h4-9,14,16,19,21,28H,10-13,15H2,1-3H3/b9-6+,28-26- |
| InChIKey | UIVQAVYYSWMDEZ-HHRFJQQDSA-N |
| XLogP | 5.82 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|