C26H25NO — CID 142916894
3-imino-6-[4-methyl-3-[(E)-2-phenylethenyl]phenyl]-2,8,9,9a-tetrahydro-1H-benzo[7]annulen-4-one (PubChem CID 142916894) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-imino-6-[4-methyl-3-[(E)-2-phenylethenyl]phenyl]-2,8,9,9a-tetrahydro-1H-benzo[7]annulen-4-one.
| Compound Name | 3-imino-6-[4-methyl-3-[(E)-2-phenylethenyl]phenyl]-2,8,9,9a-tetrahydro-1H-benzo[7]annulen-4-one |
|---|---|
| PubChem CID | 142916894 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-imino-6-[4-methyl-3-[(E)-2-phenylethenyl]phenyl]-2,8,9,9a-tetrahydro-1H-benzo[7]annulen-4-one |
| SMILES | [H]/N=C1\CCC2CCC=C(c3ccc(C)c(/C=C/c4ccccc4)c3)C=C2C1=O |
| InChI | InChI=1S/C26H25NO/c1-18-10-12-23(16-21(18)13-11-19-6-3-2-4-7-19)22-9-5-8-20-14-15-25(27)26(28)24(20)17-22/h2-4,6-7,9-13,16-17,20,27H,5,8,14-15H2,1H3/b13-11+,27-25+ |
| InChIKey | UPNRSXAAWKZFLD-AEJFMHABSA-N |
| XLogP | 6.27 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|