C19H16F3NO — CID 57285368
3-imino-2-[2-methyl-5-(trifluoromethyl)phenyl]-5-phenylcyclopentan-1-one (PubChem CID 57285368) has the molecular formula C19H16F3NO and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-imino-2-[2-methyl-5-(trifluoromethyl)phenyl]-5-phenylcyclopentan-1-one.
| Compound Name | 3-imino-2-[2-methyl-5-(trifluoromethyl)phenyl]-5-phenylcyclopentan-1-one |
|---|---|
| PubChem CID | 57285368 |
| Molecular Formula | C19H16F3NO |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-imino-2-[2-methyl-5-(trifluoromethyl)phenyl]-5-phenylcyclopentan-1-one |
| SMILES | [H]/N=C1\CC(c2ccccc2)C(=O)C1c1cc(C(F)(F)F)ccc1C |
| InChI | InChI=1S/C19H16F3NO/c1-11-7-8-13(19(20,21)22)9-14(11)17-16(23)10-15(18(17)24)12-5-3-2-4-6-12/h2-9,15,17,23H,10H2,1H3/b23-16+ |
| InChIKey | KLQSUZUIVHYPOG-XQNSMLJCSA-N |
| XLogP | 4.87 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|