C14H11ClF3NO — CID 57005137
5-(2-chloroethenyl)-3-imino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one (PubChem CID 57005137) has the molecular formula C14H11ClF3NO and a molecular weight of 301.70 g/mol. Its IUPAC name is 5-(2-chloroethenyl)-3-imino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one.
| Compound Name | 5-(2-chloroethenyl)-3-imino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57005137 |
| Molecular Formula | C14H11ClF3NO |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 5-(2-chloroethenyl)-3-imino-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
| SMILES | [H]/N=C1\CC(C=CCl)C(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11ClF3NO/c15-5-4-9-7-11(19)12(13(9)20)8-2-1-3-10(6-8)14(16,17)18/h1-6,9,12,19H,7H2/b5-4?,19-11+ |
| InChIKey | QIWNSXYECYOPKF-OMGOBSKVSA-N |
| XLogP | 4.15 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|