C14H13ClF3NO — CID 56988158
2-[3-chloro-5-(trifluoromethyl)phenyl]-5-ethyl-3-iminocyclopentan-1-one (PubChem CID 56988158) has the molecular formula C14H13ClF3NO and a molecular weight of 303.71 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)phenyl]-5-ethyl-3-iminocyclopentan-1-one.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)phenyl]-5-ethyl-3-iminocyclopentan-1-one |
|---|---|
| PubChem CID | 56988158 |
| Molecular Formula | C14H13ClF3NO |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)phenyl]-5-ethyl-3-iminocyclopentan-1-one |
| SMILES | [H]/N=C1\CC(CC)C(=O)C1c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13ClF3NO/c1-2-7-5-11(19)12(13(7)20)8-3-9(14(16,17)18)6-10(15)4-8/h3-4,6-7,12,19H,2,5H2,1H3/b19-11+ |
| InChIKey | OKSJHQMQHGAGAQ-YBFXNURJSA-N |
| XLogP | 4.46 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|