C18H13ClF3NO — CID 56991812
2-[3-chloro-5-(trifluoromethyl)phenyl]-3-imino-5-phenylcyclopentan-1-one (PubChem CID 56991812) has the molecular formula C18H13ClF3NO and a molecular weight of 351.76 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)phenyl]-3-imino-5-phenylcyclopentan-1-one.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)phenyl]-3-imino-5-phenylcyclopentan-1-one |
|---|---|
| PubChem CID | 56991812 |
| Molecular Formula | C18H13ClF3NO |
| Molecular Weight | 351.76 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)phenyl]-3-imino-5-phenylcyclopentan-1-one |
| SMILES | [H]/N=C1\CC(c2ccccc2)C(=O)C1c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13ClF3NO/c19-13-7-11(6-12(8-13)18(20,21)22)16-15(23)9-14(17(16)24)10-4-2-1-3-5-10/h1-8,14,16,23H,9H2/b23-15+ |
| InChIKey | VBQXTQIXFVBSDF-HZHRSRAPSA-N |
| XLogP | 5.22 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.76 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|