C17H20F3NO — CID 57054178
3-ethylimino-5-propyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one (PubChem CID 57054178) has the molecular formula C17H20F3NO and a molecular weight of 311.35 g/mol. Its IUPAC name is 3-ethylimino-5-propyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one.
| Compound Name | 3-ethylimino-5-propyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57054178 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-ethylimino-5-propyl-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
| SMILES | CCCC1C/C(=N\CC)C(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C17H20F3NO/c1-3-6-12-10-14(21-4-2)15(16(12)22)11-7-5-8-13(9-11)17(18,19)20/h5,7-9,12,15H,3-4,6,10H2,1-2H3/b21-14+ |
| InChIKey | DPPSZFAFOYQVBL-KGENOOAVSA-N |
| XLogP | 4.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|