C40H50FNO — CID 123830906
1-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-5-ethylidene-11-[3-fluoro-4-(4-iminocycloheptyl)phenyl]-6-methyl-9-methylideneundeca-3,6-dien-2-one (PubChem CID 123830906) has the molecular formula C40H50FNO and a molecular weight of 579.84 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-5-ethylidene-11-[3-fluoro-4-(4-iminocycloheptyl)phenyl]-6-methyl-9-methylideneundeca-3,6-dien-2-one.
| Compound Name | 1-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-5-ethylidene-11-[3-fluoro-4-(4-iminocycloheptyl)phenyl]-6-methyl-9-methylideneundeca-3,6-dien-2-one |
|---|---|
| PubChem CID | 123830906 |
| Molecular Formula | C40H50FNO |
| Molecular Weight | 579.84 g/mol |
| Exact Mass | 579.39 |
| IUPAC Name | 1-(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)-5-ethylidene-11-[3-fluoro-4-(4-iminocycloheptyl)phenyl]-6-methyl-9-methylideneundeca-3,6-dien-2-one |
| SMILES | [H]/N=C1\CCCC(c2ccc(CCC(=C)CC=C(C)C(C=CC(=O)CC3CCC(C)(C)c4ccccc43)=CC)cc2F)CC1 |
| InChI | InChI=1S/C40H50FNO/c1-6-31(20-22-35(43)27-33-24-25-40(4,5)38-13-8-7-12-36(33)38)29(3)16-14-28(2)15-17-30-18-23-37(39(41)26-30)32-10-9-11-34(42)21-19-32/h6-8,12-13,16,18,20,22-23,26,32-33,42H,2,9-11,14-15,17,19,21,24-25,27H2,1,3-5H3/b22-20?,29-16?,31-6?,42-34+ |
| InChIKey | KZEZHESBZWBGBV-TYHACOEISA-N |
| XLogP | 11.04 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.84 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|