C34H47NO — CID 91614424
(Z)-2-(5,6-dihydronaphthalen-1-yl)-6-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)propyl]-5-imino-8,9,9-trimethyldec-2-en-4-one (PubChem CID 91614424) has the molecular formula C34H47NO and a molecular weight of 485.76 g/mol. Its IUPAC name is (Z)-2-(5,6-dihydronaphthalen-1-yl)-6-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)propyl]-5-imino-8,9,9-trimethyldec-2-en-4-one.
| Compound Name | (Z)-2-(5,6-dihydronaphthalen-1-yl)-6-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)propyl]-5-imino-8,9,9-trimethyldec-2-en-4-one |
|---|---|
| PubChem CID | 91614424 |
| Molecular Formula | C34H47NO |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | (Z)-2-(5,6-dihydronaphthalen-1-yl)-6-[2-(4,5-dimethylcyclohexa-1,3-dien-1-yl)propyl]-5-imino-8,9,9-trimethyldec-2-en-4-one |
| SMILES | [H]/N=C(\C(=O)/C=C(/C)c1cccc2c1C=CCC2)C(CC(C)C1=CC=C(C)C(C)C1)CC(C)C(C)(C)C |
| InChI | InChI=1S/C34H47NO/c1-22-16-17-28(18-23(22)2)24(3)19-29(21-26(5)34(6,7)8)33(35)32(36)20-25(4)30-15-11-13-27-12-9-10-14-31(27)30/h10-11,13-17,20,23-24,26,29,35H,9,12,18-19,21H2,1-8H3/b25-20-,35-33- |
| InChIKey | RUSUHXDKAVCYDJ-OJWXIBRPSA-N |
| XLogP | 9.27 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|