C30H26FNO — CID 143783874
1-[2-fluoro-4-[(2E)-3-[4-(2-methylphenyl)-3-prop-2-enylphenyl]penta-2,4-dienimidoyl]phenyl]prop-2-en-1-one (PubChem CID 143783874) has the molecular formula C30H26FNO and a molecular weight of 435.54 g/mol. Its IUPAC name is 1-[2-fluoro-4-[(2E)-3-[4-(2-methylphenyl)-3-prop-2-enylphenyl]penta-2,4-dienimidoyl]phenyl]prop-2-en-1-one.
| Compound Name | 1-[2-fluoro-4-[(2E)-3-[4-(2-methylphenyl)-3-prop-2-enylphenyl]penta-2,4-dienimidoyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 143783874 |
| Molecular Formula | C30H26FNO |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-[2-fluoro-4-[(2E)-3-[4-(2-methylphenyl)-3-prop-2-enylphenyl]penta-2,4-dienimidoyl]phenyl]prop-2-en-1-one |
| SMILES | [H]/N=C(/C=C(\C=C)c1ccc(-c2ccccc2C)c(CC=C)c1)c1ccc(C(=O)C=C)c(F)c1 |
| InChI | InChI=1S/C30H26FNO/c1-5-10-23-17-22(13-15-26(23)25-12-9-8-11-20(25)4)21(6-2)19-29(32)24-14-16-27(28(31)18-24)30(33)7-3/h5-9,11-19,32H,1-3,10H2,4H3/b21-19+,32-29- |
| InChIKey | IWHOQSTYOWXAIM-CCMKQUEGSA-N |
| XLogP | 7.54 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|