C29H25NO2 — CID 123424097
2-[4-[3-(2-iminopropanoyl)-4-methylidenecyclohexa-1,5-dien-1-yl]-2-methylphenyl]-6-methyl-4H-benzo[7]annulen-3-one (PubChem CID 123424097) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-[4-[3-(2-iminopropanoyl)-4-methylidenecyclohexa-1,5-dien-1-yl]-2-methylphenyl]-6-methyl-4H-benzo[7]annulen-3-one.
| Compound Name | 2-[4-[3-(2-iminopropanoyl)-4-methylidenecyclohexa-1,5-dien-1-yl]-2-methylphenyl]-6-methyl-4H-benzo[7]annulen-3-one |
|---|---|
| PubChem CID | 123424097 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2-[4-[3-(2-iminopropanoyl)-4-methylidenecyclohexa-1,5-dien-1-yl]-2-methylphenyl]-6-methyl-4H-benzo[7]annulen-3-one |
| SMILES | [H]/N=C(\C)C(=O)C1C=C(c2ccc(C3=CC4=CC=C=C(C)C=C4CC3=O)c(C)c2)C=CC1=C |
| InChI | InChI=1S/C29H25NO2/c1-17-6-5-7-21-15-27(28(31)16-24(21)12-17)25-11-10-22(13-19(25)3)23-9-8-18(2)26(14-23)29(32)20(4)30/h5,7-15,26,30H,2,16H2,1,3-4H3/b30-20+ |
| InChIKey | VJWSNKXNETWRBU-TWKHWXDSSA-N |
| XLogP | 6.05 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|